C31H34N2O7 — CID 118015771
(4aR,11aR,12aS)-8-(1,3,3a,7a-tetrahydroisoindol-2-ylmethyl)-3-acetyl-10-(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 118015771) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is (4aR,11aR,12aS)-8-(1,3,3a,7a-tetrahydroisoindol-2-ylmethyl)-3-acetyl-10-(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-8-(1,3,3a,7a-tetrahydroisoindol-2-ylmethyl)-3-acetyl-10-(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 118015771 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (4aR,11aR,12aS)-8-(1,3,3a,7a-tetrahydroisoindol-2-ylmethyl)-3-acetyl-10-(dimethylamino)-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CN5CC6C=CC=CC6C5)cc(N(C)C)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C31H34N2O7/c1-15(34)24-23(35)11-20-8-18-9-21-22(32(2)3)10-19(14-33-12-16-6-4-5-7-17(16)13-33)27(36)26(21)28(37)25(18)30(39)31(20,40)29(24)38/h4-7,10,16-18,20,36-38,40H,8-9,11-14H2,1-3H3/t16?,17?,18-,20+,31-/m1/s1 |
| InChIKey | IBWXDAZRIGTCJL-IAGVVMGBSA-N |
| XLogP | 2.77 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|