C27H31F3N2O7 — CID 161399001
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(trifluoromethyl)pentyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 161399001) has the molecular formula C27H31F3N2O7 and a molecular weight of 552.55 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(trifluoromethyl)pentyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(trifluoromethyl)pentyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 161399001 |
| Molecular Formula | C27H31F3N2O7 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(trifluoromethyl)pentyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCC(CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2)C(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O7/c1-4-13(27(28,29)30)6-5-11-9-16(32(2)3)15-8-12-7-14-10-17(33)20(25(31)38)24(37)26(14,39)23(36)18(12)22(35)19(15)21(11)34/h9,12-14,34-35,37,39H,4-8,10H2,1-3H3,(H2,31,38)/t12-,13?,14+,26+/m1/s1 |
| InChIKey | AHZWXLZGSHRSAV-SPENXHETSA-N |
| XLogP | 3.01 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|