C32H30FN3O7S — CID 160872231
(4aS,5aR,12aR)-7-(dimethylamino)-9-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 160872231) has the molecular formula C32H30FN3O7S and a molecular weight of 619.67 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-9-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-9-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 160872231 |
| Molecular Formula | C32H30FN3O7S |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-9-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCc2nc(-c3ccc(F)cc3)cs2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H30FN3O7S/c1-36(2)21-11-15(5-8-23-35-20(13-44-23)14-3-6-18(33)7-4-14)27(38)25-19(21)10-16-9-17-12-22(37)26(31(34)42)30(41)32(17,43)29(40)24(16)28(25)39/h3-4,6-7,11,13,16-17,38-39,41,43H,5,8-10,12H2,1-2H3,(H2,34,42)/t16-,17+,32+/m1/s1 |
| InChIKey | CCNRIBCFMLNCHN-LUFHRXKISA-N |
| XLogP | 3.54 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|