C27H24F2N2O7 — CID 58647875
(4aS,5aR,12aR)-9-(3,4-difluorophenyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647875) has the molecular formula C27H24F2N2O7 and a molecular weight of 526.49 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(3,4-difluorophenyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(3,4-difluorophenyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647875 |
| Molecular Formula | C27H24F2N2O7 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (4aS,5aR,12aR)-9-(3,4-difluorophenyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(F)c(F)c2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H24F2N2O7/c1-31(2)17-9-13(10-3-4-15(28)16(29)7-10)22(33)20-14(17)6-11-5-12-8-18(32)21(26(30)37)25(36)27(12,38)24(35)19(11)23(20)34/h3-4,7,9,11-12,33-34,36,38H,5-6,8H2,1-2H3,(H2,30,37)/t11-,12+,27+/m1/s1 |
| InChIKey | MONFSYDKYCQOOA-NZYNRKLISA-N |
| XLogP | 2.44 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|