C25H24N2O8 — CID 54722764
7-(dimethylamino)-9-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722764) has the molecular formula C25H24N2O8 and a molecular weight of 480.47 g/mol. Its IUPAC name is 7-(dimethylamino)-9-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(dimethylamino)-9-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722764 |
| Molecular Formula | C25H24N2O8 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 7-(dimethylamino)-9-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccoc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H24N2O8/c1-27(2)15-8-13(10-3-4-35-9-10)20(29)18-14(15)6-11-5-12-7-16(28)19(24(26)33)23(32)25(12,34)22(31)17(11)21(18)30/h3-4,8-9,11-12,29-30,32,34H,5-7H2,1-2H3,(H2,26,33) |
| InChIKey | NCFKWWNBPBOATC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|