C23H19NO8 — CID 54722510
7-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722510) has the molecular formula C23H19NO8 and a molecular weight of 437.40 g/mol. Its IUPAC name is 7-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722510 |
| Molecular Formula | C23H19NO8 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 7-(furan-3-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccoc5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C23H19NO8/c24-22(30)18-15(26)7-11-5-10-6-13-12(9-3-4-32-8-9)1-2-14(25)17(13)19(27)16(10)20(28)23(11,31)21(18)29/h1-4,8,10-11,25,27,29,31H,5-7H2,(H2,24,30) |
| InChIKey | HMEJHLWJYDRDTE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|