C23H20N4O7 — CID 54722460
7-(2-aminopyrimidin-5-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722460) has the molecular formula C23H20N4O7 and a molecular weight of 464.43 g/mol. Its IUPAC name is 7-(2-aminopyrimidin-5-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(2-aminopyrimidin-5-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722460 |
| Molecular Formula | C23H20N4O7 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 7-(2-aminopyrimidin-5-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cnc(N)nc5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C23H20N4O7/c24-21(33)17-14(29)5-10-3-8-4-12-11(9-6-26-22(25)27-7-9)1-2-13(28)16(12)18(30)15(8)19(31)23(10,34)20(17)32/h1-2,6-8,10,28,30,32,34H,3-5H2,(H2,24,33)(H2,25,26,27) |
| InChIKey | KDDCGNNBCSWKCJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 209.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|