C23H24N2O7 — CID 177229477
1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229477) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229477 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrrolidin-1-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(N5CCCC5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C23H24N2O7/c24-22(31)18-15(27)9-11-7-10-8-12-13(25-5-1-2-6-25)3-4-14(26)17(12)19(28)16(10)20(29)23(11,32)21(18)30/h3-4,10-11,26,28,30,32H,1-2,5-9H2,(H2,24,31) |
| InChIKey | IMBVFGKWEIFBPS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|