C25H19F2NO7 — CID 54722454
7-(2,4-difluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722454) has the molecular formula C25H19F2NO7 and a molecular weight of 483.42 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(2,4-difluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722454 |
| Molecular Formula | C25H19F2NO7 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 7-(2,4-difluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(F)cc5F)c4CC3CC2CC1=O |
| InChI | InChI=1S/C25H19F2NO7/c26-11-1-2-13(15(27)8-11)12-3-4-16(29)19-14(12)6-9-5-10-7-17(30)20(24(28)34)23(33)25(10,35)22(32)18(9)21(19)31/h1-4,8-10,29,31,33,35H,5-7H2,(H2,28,34) |
| InChIKey | KUKFGIPZKWNJEC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|