C23H23NO7 — CID 177229495
(4aS,5aR,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229495) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229495 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (4aS,5aR,12aR)-7-cyclobutyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C5CCC5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C23H23NO7/c24-22(30)18-15(26)8-11-6-10-7-13-12(9-2-1-3-9)4-5-14(25)17(13)19(27)16(10)20(28)23(11,31)21(18)29/h4-5,9-11,25,27,29,31H,1-3,6-8H2,(H2,24,30)/t10-,11+,23+/m1/s1 |
| InChIKey | OAUFOARYHUNFEC-JQLIAFOBSA-N |
| XLogP | 1.69 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|