C26H24N2O8 — CID 134170228
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[5-(methoxymethyl)-3-pyridinyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 134170228) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[5-(methoxymethyl)-3-pyridinyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[5-(methoxymethyl)-3-pyridinyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134170228 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[5-(methoxymethyl)-3-pyridinyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COCc1cncc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C26H24N2O8/c1-36-10-11-4-13(9-28-8-11)15-2-3-17(29)20-16(15)6-12-5-14-7-18(30)21(25(27)34)24(33)26(14,35)23(32)19(12)22(20)31/h2-4,8-9,12,14,29,31,33,35H,5-7,10H2,1H3,(H2,27,34)/t12-,14+,26+/m1/s1 |
| InChIKey | RIADFOZVWBRQNQ-QYRWSJFESA-N |
| XLogP | 1.63 |
| TPSA | 180.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|