C31H31NO7 — CID 140505448
(4aS,5aR,12aR)-7-[3-(cyclopentylmethyl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505448) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[3-(cyclopentylmethyl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[3-(cyclopentylmethyl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505448 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (4aS,5aR,12aR)-7-[3-(cyclopentylmethyl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(CC6CCCC6)c5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C31H31NO7/c32-30(38)26-23(34)14-19-12-18-13-21-20(17-7-3-6-16(11-17)10-15-4-1-2-5-15)8-9-22(33)25(21)27(35)24(18)28(36)31(19,39)29(26)37/h3,6-9,11,15,18-19,33,35,37,39H,1-2,4-5,10,12-14H2,(H2,32,38)/t18-,19+,31+/m1/s1 |
| InChIKey | JPUQJMWFQPFCKB-YEVIJXJFSA-N |
| XLogP | 3.82 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|