C30H32N2O10 — CID 118016076
(4aS,5aR,12aR)-7-[3-[[(2-ethoxy-2-hydroxyethyl)amino]-hydroxymethyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118016076) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[3-[[(2-ethoxy-2-hydroxyethyl)amino]-hydroxymethyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[3-[[(2-ethoxy-2-hydroxyethyl)amino]-hydroxymethyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118016076 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | (4aS,5aR,12aR)-7-[3-[[(2-ethoxy-2-hydroxyethyl)amino]-hydroxymethyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCOC(O)CNC(O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C30H32N2O10/c1-2-42-21(35)12-32-29(40)14-5-3-4-13(8-14)17-6-7-19(33)23-18(17)10-15-9-16-11-20(34)24(28(31)39)27(38)30(16,41)26(37)22(15)25(23)36/h3-8,15-16,21,29,32-33,35-36,38,40-41H,2,9-12H2,1H3,(H2,31,39)/t15-,16+,21?,29?,30+/m1/s1 |
| InChIKey | JBAJUONMYKDDLX-QRRJQVGJSA-N |
| XLogP | 1.03 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|