C23H21N3O7 — CID 177229100
(12aR)-1,10,11,12a-tetrahydroxy-7-(1-methylpyrazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229100) has the molecular formula C23H21N3O7 and a molecular weight of 451.44 g/mol. Its IUPAC name is (12aR)-1,10,11,12a-tetrahydroxy-7-(1-methylpyrazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (12aR)-1,10,11,12a-tetrahydroxy-7-(1-methylpyrazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229100 |
| Molecular Formula | C23H21N3O7 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (12aR)-1,10,11,12a-tetrahydroxy-7-(1-methylpyrazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cn1cc(-c2ccc(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cn1 |
| InChI | InChI=1S/C23H21N3O7/c1-26-8-10(7-25-26)12-2-3-14(27)17-13(12)5-9-4-11-6-15(28)18(22(24)32)21(31)23(11,33)20(30)16(9)19(17)29/h2-3,7-9,11,27,29,31,33H,4-6H2,1H3,(H2,24,32)/t9?,11?,23-/m0/s1 |
| InChIKey | BLWMFJCWICKKBH-DSBWQRROSA-N |
| XLogP | 0.82 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|