C27H24N2O9 — CID 54698544
1,10,11,12a-tetrahydroxy-7-[3-(methoxycarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54698544) has the molecular formula C27H24N2O9 and a molecular weight of 520.49 g/mol. Its IUPAC name is 1,10,11,12a-tetrahydroxy-7-[3-(methoxycarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,10,11,12a-tetrahydroxy-7-[3-(methoxycarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54698544 |
| Molecular Formula | C27H24N2O9 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 1,10,11,12a-tetrahydroxy-7-[3-(methoxycarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CONC(=O)c1cccc(-c2ccc(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C27H24N2O9/c1-38-29-26(36)12-4-2-3-11(7-12)15-5-6-17(30)20-16(15)9-13-8-14-10-18(31)21(25(28)35)24(34)27(14,37)23(33)19(13)22(20)32/h2-7,13-14,30,32,34,37H,8-10H2,1H3,(H2,28,35)(H,29,36) |
| InChIKey | KCGPNWMIBMNXIS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|