C33H38N4O7 — CID 58647705
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647705) has the molecular formula C33H38N4O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647705 |
| Molecular Formula | C33H38N4O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN1CCN(Cc2cccc(-c3cc(N(C)C)c4c(c3O)C(O)=C3C(=O)[C@]5(O)C(O)=C(C(N)=O)C(=O)C[C@@H]5C[C@@H]3C4)c2)CC1 |
| InChI | InChI=1S/C33H38N4O7/c1-35(2)23-15-21(18-6-4-5-17(11-18)16-37-9-7-36(3)8-10-37)28(39)26-22(23)13-19-12-20-14-24(38)27(32(34)43)31(42)33(20,44)30(41)25(19)29(26)40/h4-6,11,15,19-20,39-40,42,44H,7-10,12-14,16H2,1-3H3,(H2,34,43)/t19-,20+,33+/m1/s1 |
| InChIKey | AEKIFMHTELZZFJ-FSSPWDJASA-N |
| XLogP | 1.90 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|