C23H22N2O10 — CID 118554326
2-[(10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-oxoacetic acid (PubChem CID 118554326) has the molecular formula C23H22N2O10 and a molecular weight of 486.43 g/mol. Its IUPAC name is 2-[(10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[(10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 118554326 |
| Molecular Formula | C23H22N2O10 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[(10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-2-oxoacetic acid |
| SMILES | CN(C)c1cc(C(=O)C(=O)O)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H22N2O10/c1-25(2)11-6-10(17(28)22(33)34)16(27)14-9(11)4-7-3-8-5-12(26)15(21(24)32)20(31)23(8,35)19(30)13(7)18(14)29/h6-8,27,29,31,35H,3-5H2,1-2H3,(H2,24,32)(H,33,34)/t7?,8?,23-/m0/s1 |
| InChIKey | DEKYRZHCIISSCS-UCLGHODDSA-N |
| XLogP | -0.24 |
| TPSA | 215.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|