C29H25N3O9 — CID 58647432
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(4-nitrophenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647432) has the molecular formula C29H25N3O9 and a molecular weight of 559.53 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(4-nitrophenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(4-nitrophenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647432 |
| Molecular Formula | C29H25N3O9 |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(4-nitrophenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#Cc2ccc([N+](=O)[O-])cc2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H25N3O9/c1-31(2)19-11-14(6-3-13-4-7-17(8-5-13)32(40)41)24(34)22-18(19)10-15-9-16-12-20(33)23(28(30)38)27(37)29(16,39)26(36)21(15)25(22)35/h4-5,7-8,11,15-16,34-35,37,39H,9-10,12H2,1-2H3,(H2,30,38)/t15-,16+,29+/m1/s1 |
| InChIKey | KIIDOIKOTFRUJP-YPOBSOSXSA-N |
| XLogP | 1.80 |
| TPSA | 204.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|