C28H26ClN5O10 — CID 58648198
(4aS,5aR,12aR)-9-[(4-chloro-2-nitrophenyl)carbamoylamino]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58648198) has the molecular formula C28H26ClN5O10 and a molecular weight of 627.99 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-[(4-chloro-2-nitrophenyl)carbamoylamino]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-[(4-chloro-2-nitrophenyl)carbamoylamino]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58648198 |
| Molecular Formula | C28H26ClN5O10 |
| Molecular Weight | 627.99 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | (4aS,5aR,12aR)-9-[(4-chloro-2-nitrophenyl)carbamoylamino]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H26ClN5O10/c1-33(2)16-9-15(32-27(41)31-14-4-3-12(29)8-17(14)34(43)44)22(36)20-13(16)6-10-5-11-7-18(35)21(26(30)40)25(39)28(11,42)24(38)19(10)23(20)37/h3-4,8-11,36-37,39,42H,5-7H2,1-2H3,(H2,30,40)(H2,31,32,41)/t10-,11+,28+/m1/s1 |
| InChIKey | BMXOYVWQABASDH-BKEFGGNHSA-N |
| XLogP | 2.70 |
| TPSA | 245.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.99 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|