C26H31N3O8 — CID 54740270
(4aS,5aR,12aR)-9-N-tert-butyl-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide (PubChem CID 54740270) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-N-tert-butyl-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide.
| Compound Name | (4aS,5aR,12aR)-9-N-tert-butyl-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide |
|---|---|
| PubChem CID | 54740270 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (4aS,5aR,12aR)-9-N-tert-butyl-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2,9-dicarboxamide |
| SMILES | CN(C)c1cc(C(=O)NC(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H31N3O8/c1-25(2,3)28-24(36)13-9-14(29(4)5)12-7-10-6-11-8-15(30)18(23(27)35)22(34)26(11,37)21(33)16(10)20(32)17(12)19(13)31/h9-11,31-32,34,37H,6-8H2,1-5H3,(H2,27,35)(H,28,36)/t10-,11+,26+/m1/s1 |
| InChIKey | RYXLGFXYMFKOLP-FEEKEVSISA-N |
| XLogP | 1.02 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|