C24H27N3O9 — CID 54720879
ethyl N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate (PubChem CID 54720879) has the molecular formula C24H27N3O9 and a molecular weight of 501.49 g/mol. Its IUPAC name is ethyl N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate.
| Compound Name | ethyl N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 54720879 |
| Molecular Formula | C24H27N3O9 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | ethyl N-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H27N3O9/c1-4-36-23(34)26-12-8-13(27(2)3)11-6-9-5-10-7-14(28)17(22(25)33)21(32)24(10,35)20(31)15(9)19(30)16(11)18(12)29/h8-10,29-30,32,35H,4-7H2,1-3H3,(H2,25,33)(H,26,34)/t9-,10+,24+/m1/s1 |
| InChIKey | UDDZQSXPLNIEOS-IGSRQBSMSA-N |
| XLogP | 1.06 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|