C30H31N3O8 — CID 54722649
7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(3-oxo-3-phenylpropyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722649) has the molecular formula C30H31N3O8 and a molecular weight of 561.59 g/mol. Its IUPAC name is 7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(3-oxo-3-phenylpropyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(3-oxo-3-phenylpropyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722649 |
| Molecular Formula | C30H31N3O8 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(3-oxo-3-phenylpropyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCCC(=O)c2ccccc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H31N3O8/c1-33(2)19-13-18(32-9-8-20(34)14-6-4-3-5-7-14)25(36)23-17(19)11-15-10-16-12-21(35)24(29(31)40)28(39)30(16,41)27(38)22(15)26(23)37/h3-7,13,15-16,32,36-37,39,41H,8-12H2,1-2H3,(H2,31,40) |
| InChIKey | JKRLTUYMISSUOU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|