C29H28ClN3O9 — CID 54722401
(4-chlorophenyl) N-[[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 54722401) has the molecular formula C29H28ClN3O9 and a molecular weight of 598.01 g/mol. Its IUPAC name is (4-chlorophenyl) N-[[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54722401 |
| Molecular Formula | C29H28ClN3O9 |
| Molecular Weight | 598.01 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | (4-chlorophenyl) N-[[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | CN(C)c1cc(CNC(=O)Oc2ccc(Cl)cc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H28ClN3O9/c1-33(2)18-9-13(11-32-28(40)42-16-5-3-15(30)4-6-16)23(35)21-17(18)8-12-7-14-10-19(34)22(27(31)39)26(38)29(14,41)25(37)20(12)24(21)36/h3-6,9,12,14,35-36,38,41H,7-8,10-11H2,1-2H3,(H2,31,39)(H,32,40) |
| InChIKey | DIBXHJZUBCWUGQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.01 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|