C30H30F3N3O8 — CID 58647797
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]methylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647797) has the molecular formula C30H30F3N3O8 and a molecular weight of 617.58 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]methylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]methylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647797 |
| Molecular Formula | C30H30F3N3O8 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[[4-(trifluoromethoxy)phenyl]methylamino]methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNCc2ccc(OC(F)(F)F)cc2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H30F3N3O8/c1-36(2)19-9-15(12-35-11-13-3-5-17(6-4-13)44-30(31,32)33)24(38)22-18(19)8-14-7-16-10-20(37)23(28(34)42)27(41)29(16,43)26(40)21(14)25(22)39/h3-6,9,14,16,35,38-39,41,43H,7-8,10-12H2,1-2H3,(H2,34,42)/t14-,16+,29+/m1/s1 |
| InChIKey | TXFRPSYFAMZZMN-NIDLEFHJSA-N |
| XLogP | 2.68 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|