C28H30N2O9 — CID 134184631
butyl 3-[(6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-ynoate (PubChem CID 134184631) has the molecular formula C28H30N2O9 and a molecular weight of 538.55 g/mol. Its IUPAC name is butyl 3-[(6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-ynoate.
| Compound Name | butyl 3-[(6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 134184631 |
| Molecular Formula | C28H30N2O9 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | butyl 3-[(6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-ynoate |
| SMILES | CCCCOC(=O)C#Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3CC1C2 |
| InChI | InChI=1S/C28H30N2O9/c1-4-5-8-39-19(32)7-6-13-11-17(30(2)3)16-10-14-9-15-12-18(31)22(27(29)37)26(36)28(15,38)25(35)20(14)24(34)21(16)23(13)33/h11,14-15,33-34,36,38H,4-5,8-10,12H2,1-3H3,(H2,29,37)/t14?,15-,28-/m0/s1 |
| InChIKey | DXBUQWZNYAUJRS-YOYZZMOHSA-N |
| XLogP | 1.18 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|