C28H32N2O9 — CID 54723001
butyl (E)-3-[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate (PubChem CID 54723001) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is butyl (E)-3-[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54723001 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | butyl (E)-3-[9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C28H32N2O9/c1-4-5-8-39-19(32)7-6-13-11-17(30(2)3)16-10-14-9-15-12-18(31)22(27(29)37)26(36)28(15,38)25(35)20(14)24(34)21(16)23(13)33/h6-7,11,14-15,33-34,36,38H,4-5,8-10,12H2,1-3H3,(H2,29,37)/b7-6+ |
| InChIKey | FMKIEZGCCRMMSI-VOTSOKGWSA-N |
| XLogP | 1.85 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|