C27H29N3O9 — CID 88958204
3-(dimethylamino)propyl (E)-3-[(6aR,10aS,11aR)-8-carbamoyl-5,6a,7-trihydroxy-4-nitroso-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate (PubChem CID 88958204) has the molecular formula C27H29N3O9 and a molecular weight of 539.54 g/mol. Its IUPAC name is 3-(dimethylamino)propyl (E)-3-[(6aR,10aS,11aR)-8-carbamoyl-5,6a,7-trihydroxy-4-nitroso-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate.
| Compound Name | 3-(dimethylamino)propyl (E)-3-[(6aR,10aS,11aR)-8-carbamoyl-5,6a,7-trihydroxy-4-nitroso-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 88958204 |
| Molecular Formula | C27H29N3O9 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 3-(dimethylamino)propyl (E)-3-[(6aR,10aS,11aR)-8-carbamoyl-5,6a,7-trihydroxy-4-nitroso-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-enoate |
| SMILES | CN(C)CCCOC(=O)/C=C/c1ccc(N=O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H29N3O9/c1-30(2)8-3-9-39-19(32)7-5-13-4-6-17(29-38)21-16(13)11-14-10-15-12-18(31)22(26(28)36)25(35)27(15,37)24(34)20(14)23(21)33/h4-7,14-15,33,35,37H,3,8-12H2,1-2H3,(H2,28,36)/b7-5+/t14-,15+,27+/m1/s1 |
| InChIKey | RBOYOFNKOVLJAZ-CDSMMSGTSA-N |
| XLogP | 1.62 |
| TPSA | 196.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|