C22H23NO7 — CID 54722301
1,11,12a-trihydroxy-3,12-dioxo-10-propoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722301) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1,11,12a-trihydroxy-3,12-dioxo-10-propoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,11,12a-trihydroxy-3,12-dioxo-10-propoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722301 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1,11,12a-trihydroxy-3,12-dioxo-10-propoxy-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCOc1cccc2c1C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C22H23NO7/c1-2-6-30-14-5-3-4-10-7-11-8-12-9-13(24)17(21(23)28)20(27)22(12,29)19(26)16(11)18(25)15(10)14/h3-5,11-12,25,27,29H,2,6-9H2,1H3,(H2,23,28) |
| InChIKey | DSAYNZXCOXBQAM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|