C19H17ClN2O7 — CID 54680465
(4aS,5aR,12aR)-9-amino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680465) has the molecular formula C19H17ClN2O7 and a molecular weight of 420.81 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-amino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-amino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680465 |
| Molecular Formula | C19H17ClN2O7 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (4aS,5aR,12aR)-9-amino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc(Cl)c(N)c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C19H17ClN2O7/c20-8-3-6-1-5-2-7-4-9(23)12(18(22)28)17(27)19(7,29)16(26)11(5)14(24)10(6)15(25)13(8)21/h3,5,7,24-25,27,29H,1-2,4,21H2,(H2,22,28)/t5-,7-,19-/m0/s1 |
| InChIKey | QRGHKHDAMVQCHZ-DOKIEFESSA-N |
| XLogP | 0.66 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|