C26H25FN2O7 — CID 88576278
(4aS,5aR,14aR)-10-[(2-fluoroethylamino)methyl]-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 88576278) has the molecular formula C26H25FN2O7 and a molecular weight of 496.49 g/mol. Its IUPAC name is (4aS,5aR,14aR)-10-[(2-fluoroethylamino)methyl]-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4aS,5aR,14aR)-10-[(2-fluoroethylamino)methyl]-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 88576278 |
| Molecular Formula | C26H25FN2O7 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (4aS,5aR,14aR)-10-[(2-fluoroethylamino)methyl]-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5ccc(CNCCF)cc5c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C26H25FN2O7/c27-3-4-29-10-11-1-2-12-6-13-7-14-8-15-9-17(30)20(25(28)35)24(34)26(15,36)23(33)19(14)22(32)18(13)21(31)16(12)5-11/h1-2,5-6,14-15,29,31-32,34,36H,3-4,7-10H2,(H2,28,35)/t14-,15-,26-/m0/s1 |
| InChIKey | CIFZHPQYAKOYLP-USBFQFRLSA-N |
| XLogP | 1.64 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|