C26H23FN2O7 — CID 54722932
9-(aminomethyl)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722932) has the molecular formula C26H23FN2O7 and a molecular weight of 494.48 g/mol. Its IUPAC name is 9-(aminomethyl)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(aminomethyl)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722932 |
| Molecular Formula | C26H23FN2O7 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 9-(aminomethyl)-7-(4-fluorophenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NCc1cc(-c2ccc(F)cc2)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C26H23FN2O7/c27-14-3-1-10(2-4-14)15-7-12(9-28)21(31)19-16(15)6-11-5-13-8-17(30)20(25(29)35)24(34)26(13,36)23(33)18(11)22(19)32/h1-4,7,11,13,31-32,34,36H,5-6,8-9,28H2,(H2,29,35) |
| InChIKey | XEXLJHLGTKBIFA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|