C26H23N3O9 — CID 54720883
(4aS,5aR,12aR)-9-(aminomethyl)-1,10,11,12a-tetrahydroxy-7-(3-nitrophenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54720883) has the molecular formula C26H23N3O9 and a molecular weight of 521.48 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(aminomethyl)-1,10,11,12a-tetrahydroxy-7-(3-nitrophenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(aminomethyl)-1,10,11,12a-tetrahydroxy-7-(3-nitrophenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54720883 |
| Molecular Formula | C26H23N3O9 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (4aS,5aR,12aR)-9-(aminomethyl)-1,10,11,12a-tetrahydroxy-7-(3-nitrophenyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NCc1cc(-c2cccc([N+](=O)[O-])c2)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C26H23N3O9/c27-9-12-7-15(10-2-1-3-14(5-10)29(37)38)16-6-11-4-13-8-17(30)20(25(28)35)24(34)26(13,36)23(33)18(11)22(32)19(16)21(12)31/h1-3,5,7,11,13,31-32,34,36H,4,6,8-9,27H2,(H2,28,35)/t11-,13+,26+/m1/s1 |
| InChIKey | AQNAMQDSCQHMSS-NJAKMQSKSA-N |
| XLogP | 1.46 |
| TPSA | 227.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|