C29H27NO8 — CID 140506073
(4aS,5aR,12aR)-9-(3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140506073) has the molecular formula C29H27NO8 and a molecular weight of 517.53 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506073 |
| Molecular Formula | C29H27NO8 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (4aS,5aR,12aR)-9-(3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)c1cc(-c2cccc(C=O)c2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H27NO8/c1-12(2)17-10-18(14-5-3-4-13(6-14)11-31)24(33)22-19(17)8-15-7-16-9-20(32)23(28(30)37)27(36)29(16,38)26(35)21(15)25(22)34/h3-6,10-12,15-16,33-34,36,38H,7-9H2,1-2H3,(H2,30,37)/t15-,16+,29+/m1/s1 |
| InChIKey | QGZGTRJJMNCTSF-YPOBSOSXSA-N |
| XLogP | 3.03 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|