C28H26N2O9 — CID 90758490
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-9-(3-nitrophenyl)-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 90758490) has the molecular formula C28H26N2O9 and a molecular weight of 534.52 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-9-(3-nitrophenyl)-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-9-(3-nitrophenyl)-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90758490 |
| Molecular Formula | C28H26N2O9 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-9-(3-nitrophenyl)-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)c1cc(-c2cccc([N+](=O)[O-])c2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H26N2O9/c1-11(2)16-10-17(12-4-3-5-15(7-12)30(38)39)23(32)21-18(16)8-13-6-14-9-19(31)22(27(29)36)26(35)28(14,37)25(34)20(13)24(21)33/h3-5,7,10-11,13-14,32-33,35,37H,6,8-9H2,1-2H3,(H2,29,36)/t13-,14+,28+/m1/s1 |
| InChIKey | KVMWLSXJFZCCKV-VSGRFQRGSA-N |
| XLogP | 3.12 |
| TPSA | 201.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|