C35H26N2O11 — CID 54722373
3-[8-carbamoyl-3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoic acid (PubChem CID 54722373) has the molecular formula C35H26N2O11 and a molecular weight of 650.60 g/mol. Its IUPAC name is 3-[8-carbamoyl-3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoic acid.
| Compound Name | 3-[8-carbamoyl-3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoic acid |
|---|---|
| PubChem CID | 54722373 |
| Molecular Formula | C35H26N2O11 |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 3-[8-carbamoyl-3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoic acid |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(CN5C(=O)c6ccccc6C5=O)cc(-c5cccc(C(=O)O)c5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C35H26N2O11/c36-31(43)26-23(38)12-18-9-16-10-22-21(14-4-3-5-15(8-14)34(46)47)11-17(13-37-32(44)19-6-1-2-7-20(19)33(37)45)27(39)25(22)28(40)24(16)29(41)35(18,48)30(26)42/h1-8,11,16,18,39-40,42,48H,9-10,12-13H2,(H2,36,43)(H,46,47) |
| InChIKey | CFITVDYDJJEIRV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 232.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|