C26H31FN2O7 — CID 130468059
(4aS,12aR)-9-[3-(tert-butylamino)propyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 130468059) has the molecular formula C26H31FN2O7 and a molecular weight of 502.54 g/mol. Its IUPAC name is (4aS,12aR)-9-[3-(tert-butylamino)propyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-9-[3-(tert-butylamino)propyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 130468059 |
| Molecular Formula | C26H31FN2O7 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (4aS,12aR)-9-[3-(tert-butylamino)propyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)NCCCc1cc(F)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3CC1C2 |
| InChI | InChI=1S/C26H31FN2O7/c1-25(2,3)29-6-4-5-11-9-15(27)14-8-12-7-13-10-16(30)19(24(28)35)23(34)26(13,36)22(33)17(12)21(32)18(14)20(11)31/h9,12-13,29,31-32,34,36H,4-8,10H2,1-3H3,(H2,28,35)/t12?,13-,26-/m0/s1 |
| InChIKey | GFCUVEIRKLBHOF-XDHAOJBOSA-N |
| XLogP | 1.88 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|