C30H29F3N2O7 — CID 157224502
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(3,4,5-trifluorophenyl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 157224502) has the molecular formula C30H29F3N2O7 and a molecular weight of 586.56 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(3,4,5-trifluorophenyl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(3,4,5-trifluorophenyl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 157224502 |
| Molecular Formula | C30H29F3N2O7 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(3,4,5-trifluorophenyl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCCc2cc(F)c(F)c(F)c2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H29F3N2O7/c1-35(2)19-10-13(5-3-4-12-6-17(31)24(33)18(32)7-12)25(37)22-16(19)9-14-8-15-11-20(36)23(29(34)41)28(40)30(15,42)27(39)21(14)26(22)38/h6-7,10,14-15,37-38,40,42H,3-5,8-9,11H2,1-2H3,(H2,34,41)/t14-,15+,30+/m1/s1 |
| InChIKey | SLXYJXXUBVVPAZ-PWUJBNGKSA-N |
| XLogP | 3.08 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|