C25H28F2N2O7 — CID 158908312
(4aS,5aR,12aR)-9-(4,4-difluorobutyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 158908312) has the molecular formula C25H28F2N2O7 and a molecular weight of 506.50 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(4,4-difluorobutyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(4,4-difluorobutyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 158908312 |
| Molecular Formula | C25H28F2N2O7 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (4aS,5aR,12aR)-9-(4,4-difluorobutyl)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCCC(F)F)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H28F2N2O7/c1-29(2)14-8-10(4-3-5-16(26)27)20(31)18-13(14)7-11-6-12-9-15(30)19(24(28)35)23(34)25(12,36)22(33)17(11)21(18)32/h8,11-12,16,31-32,34,36H,3-7,9H2,1-2H3,(H2,28,35)/t11-,12+,25+/m1/s1 |
| InChIKey | AQWKHBVGRYMLOQ-FIRCGALFSA-N |
| XLogP | 2.08 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|