C29H36N2O8 — CID 172950262
(4aS,5aR,12aR)-9-(4,4-dimethylpentyl)-1,10,11,12a-tetrahydroxy-7-[(E)-N-methoxy-C-methylcarbonimidoyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 172950262) has the molecular formula C29H36N2O8 and a molecular weight of 540.61 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(4,4-dimethylpentyl)-1,10,11,12a-tetrahydroxy-7-[(E)-N-methoxy-C-methylcarbonimidoyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(4,4-dimethylpentyl)-1,10,11,12a-tetrahydroxy-7-[(E)-N-methoxy-C-methylcarbonimidoyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 172950262 |
| Molecular Formula | C29H36N2O8 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (4aS,5aR,12aR)-9-(4,4-dimethylpentyl)-1,10,11,12a-tetrahydroxy-7-[(E)-N-methoxy-C-methylcarbonimidoyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CO/N=C(\C)c1cc(CCCC(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H36N2O8/c1-13(31-39-5)17-10-14(7-6-8-28(2,3)4)23(33)21-18(17)11-15-9-16-12-19(32)22(27(30)37)26(36)29(16,38)25(35)20(15)24(21)34/h10,15-16,33-34,36,38H,6-9,11-12H2,1-5H3,(H2,30,37)/b31-13+/t15-,16+,29+/m1/s1 |
| InChIKey | WMULCLKVKYFWMQ-UZNKWMIQSA-N |
| XLogP | 3.16 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|