C27H31NO7 — CID 158162852
(4aS,5aR,12aR)-9-(2-cyclohexylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 158162852) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(2-cyclohexylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(2-cyclohexylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 158162852 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (4aS,5aR,12aR)-9-(2-cyclohexylethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(CCC5CCCCC5)c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C27H31NO7/c28-26(34)21-18(29)12-17-11-16-10-15-9-8-14(7-6-13-4-2-1-3-5-13)22(30)19(15)23(31)20(16)24(32)27(17,35)25(21)33/h8-9,13,16-17,30-31,33,35H,1-7,10-12H2,(H2,28,34)/t16-,17-,27-/m0/s1 |
| InChIKey | TUMLQJWULQNALZ-FXUCQVAHSA-N |
| XLogP | 2.94 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|