C30H31N3O7 — CID 140505539
(4aS,5aR,12aR)-9-(cyclohexylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrimidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505539) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(cyclohexylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrimidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(cyclohexylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrimidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505539 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | (4aS,5aR,12aR)-9-(cyclohexylmethyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-pyrimidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CC5CCCCC5)cc(-c5ncccn5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C30H31N3O7/c31-28(39)23-20(34)13-17-10-15-11-18-19(29-32-7-4-8-33-29)12-16(9-14-5-2-1-3-6-14)24(35)22(18)25(36)21(15)26(37)30(17,40)27(23)38/h4,7-8,12,14-15,17,35-36,38,40H,1-3,5-6,9-11,13H2,(H2,31,39)/t15-,17+,30+/m1/s1 |
| InChIKey | JAYLFXXLMPUMRK-IGWBVUALSA-N |
| XLogP | 3.00 |
| TPSA | 183.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|