C32H43N3O7 — CID 126598205
(4aS,12aR)-8-[[2-cyclohexylethyl(ethyl)amino]methyl]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598205) has the molecular formula C32H43N3O7 and a molecular weight of 581.71 g/mol. Its IUPAC name is (4aS,12aR)-8-[[2-cyclohexylethyl(ethyl)amino]methyl]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[2-cyclohexylethyl(ethyl)amino]methyl]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598205 |
| Molecular Formula | C32H43N3O7 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | (4aS,12aR)-8-[[2-cyclohexylethyl(ethyl)amino]methyl]-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(CCC1CCCCC1)Cc1cc(O)c2c(c1N(C)C)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H43N3O7/c1-4-35(11-10-17-8-6-5-7-9-17)16-19-14-22(36)25-21(27(19)34(2)3)13-18-12-20-15-23(37)26(31(33)41)30(40)32(20,42)29(39)24(18)28(25)38/h14,17-18,20,36,38,40,42H,4-13,15-16H2,1-3H3,(H2,33,41)/t18?,20-,32-/m0/s1 |
| InChIKey | AXDBAJKNSZYJRX-ZMCMMXAFSA-N |
| XLogP | 3.28 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|