C30H35F3N2O8 — CID 126598254
(4aS,12aR)-8-[[cyclopropylmethyl(2-propan-2-yloxyethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598254) has the molecular formula C30H35F3N2O8 and a molecular weight of 608.61 g/mol. Its IUPAC name is (4aS,12aR)-8-[[cyclopropylmethyl(2-propan-2-yloxyethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[cyclopropylmethyl(2-propan-2-yloxyethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598254 |
| Molecular Formula | C30H35F3N2O8 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (4aS,12aR)-8-[[cyclopropylmethyl(2-propan-2-yloxyethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)OCCN(Cc1cc(O)c2c(c1C(F)(F)F)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC1CC1 |
| InChI | InChI=1S/C30H35F3N2O8/c1-13(2)43-6-5-35(11-14-3-4-14)12-16-9-19(36)22-18(24(16)30(31,32)33)8-15-7-17-10-20(37)23(28(34)41)27(40)29(17,42)26(39)21(15)25(22)38/h9,13-15,17,36,38,40,42H,3-8,10-12H2,1-2H3,(H2,34,41)/t15?,17-,29-/m0/s1 |
| InChIKey | CFRKQATWFUOAFF-QHDGPWPZSA-N |
| XLogP | 3.08 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|