C33H33F3N2O7 — CID 126598045
(4aS,12aR)-8-[[cyclopropylmethyl(2-phenylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598045) has the molecular formula C33H33F3N2O7 and a molecular weight of 626.63 g/mol. Its IUPAC name is (4aS,12aR)-8-[[cyclopropylmethyl(2-phenylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[cyclopropylmethyl(2-phenylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598045 |
| Molecular Formula | C33H33F3N2O7 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | (4aS,12aR)-8-[[cyclopropylmethyl(2-phenylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CN(CCc5ccccc5)CC5CC5)c(C(F)(F)F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C33H33F3N2O7/c34-33(35,36)27-19(15-38(14-17-6-7-17)9-8-16-4-2-1-3-5-16)12-22(39)25-21(27)11-18-10-20-13-23(40)26(31(37)44)30(43)32(20,45)29(42)24(18)28(25)41/h1-5,12,17-18,20,39,41,43,45H,6-11,13-15H2,(H2,37,44)/t18?,20-,32-/m0/s1 |
| InChIKey | ADCWRRCXUSRIPG-ZMCMMXAFSA-N |
| XLogP | 3.90 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|