C27H25FN2O9S — CID 126598095
(4aS,12aR)-8-[[benzenesulfonyl(methyl)amino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598095) has the molecular formula C27H25FN2O9S and a molecular weight of 572.57 g/mol. Its IUPAC name is (4aS,12aR)-8-[[benzenesulfonyl(methyl)amino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[benzenesulfonyl(methyl)amino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598095 |
| Molecular Formula | C27H25FN2O9S |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | (4aS,12aR)-8-[[benzenesulfonyl(methyl)amino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(Cc1cc(O)c2c(c1F)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H25FN2O9S/c1-30(40(38,39)15-5-3-2-4-6-15)11-13-9-17(31)20-16(22(13)28)8-12-7-14-10-18(32)21(26(29)36)25(35)27(14,37)24(34)19(12)23(20)33/h2-6,9,12,14,31,33,35,37H,7-8,10-11H2,1H3,(H2,29,36)/t12?,14-,27-/m0/s1 |
| InChIKey | AOPLVGOOLYDXFM-MTSCWLGPSA-N |
| XLogP | 1.38 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|