C27H33ClN2O8 — CID 138459577
(4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-methylamino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 138459577) has the molecular formula C27H33ClN2O8 and a molecular weight of 549.02 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-methylamino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-methylamino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138459577 |
| Molecular Formula | C27H33ClN2O8 |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-methylamino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(Cc1cc(O)c2c(c1Cl)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C27H33ClN2O8/c1-26(2,3)17(10-31)30(4)9-12-7-15(32)19-14(21(12)28)6-11-5-13-8-16(33)20(25(29)37)24(36)27(13,38)23(35)18(11)22(19)34/h7,11,13,17,31-32,34,36,38H,5-6,8-10H2,1-4H3,(H2,29,37)/t11?,13-,17+,27-/m0/s1 |
| InChIKey | MGOFKLMSHRRTCT-NYGZFVFUSA-N |
| XLogP | 1.92 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|