C30H36ClN3O7 — CID 126597359
(4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126597359) has the molecular formula C30H36ClN3O7 and a molecular weight of 586.09 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126597359 |
| Molecular Formula | C30H36ClN3O7 |
| Molecular Weight | 586.09 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CN(CCN5CCCC5)CC5CC5)c(Cl)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C30H36ClN3O7/c31-25-17(14-34(13-15-3-4-15)8-7-33-5-1-2-6-33)11-20(35)23-19(25)10-16-9-18-12-21(36)24(29(32)40)28(39)30(18,41)27(38)22(16)26(23)37/h11,15-16,18,35,37,39,41H,1-10,12-14H2,(H2,32,40)/t16?,18-,30-/m0/s1 |
| InChIKey | MKDXXXAQDPDTRU-LPNJRDJKSA-N |
| XLogP | 2.39 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|