C32H37ClN2O7 — CID 126597196
(4aS,12aR)-8-[[1-adamantylmethyl(methyl)amino]methyl]-7-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126597196) has the molecular formula C32H37ClN2O7 and a molecular weight of 597.11 g/mol. Its IUPAC name is (4aS,12aR)-8-[[1-adamantylmethyl(methyl)amino]methyl]-7-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[1-adamantylmethyl(methyl)amino]methyl]-7-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126597196 |
| Molecular Formula | C32H37ClN2O7 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (4aS,12aR)-8-[[1-adamantylmethyl(methyl)amino]methyl]-7-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(Cc1cc(O)c2c(c1Cl)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H37ClN2O7/c1-35(13-31-9-14-2-15(10-31)4-16(3-14)11-31)12-18-7-21(36)24-20(26(18)33)6-17-5-19-8-22(37)25(30(34)41)29(40)32(19,42)28(39)23(17)27(24)38/h7,14-17,19,36,38,40,42H,2-6,8-13H2,1H3,(H2,34,41)/t14?,15?,16?,17?,19-,31?,32-/m0/s1 |
| InChIKey | JHRWJZBOKHAUGR-KKZAWDCVSA-N |
| XLogP | 3.73 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|