C30H37ClN2O7 — CID 126598164
(4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(3,3-dimethylbutyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598164) has the molecular formula C30H37ClN2O7 and a molecular weight of 573.09 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(3,3-dimethylbutyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(3,3-dimethylbutyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598164 |
| Molecular Formula | C30H37ClN2O7 |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (4aS,12aR)-7-chloro-8-[[cyclopropylmethyl(3,3-dimethylbutyl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)CCN(Cc1cc(O)c2c(c1Cl)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC1CC1 |
| InChI | InChI=1S/C30H37ClN2O7/c1-29(2,3)6-7-33(12-14-4-5-14)13-16-10-19(34)22-18(24(16)31)9-15-8-17-11-20(35)23(28(32)39)27(38)30(17,40)26(37)21(15)25(22)36/h10,14-15,17,34,36,38,40H,4-9,11-13H2,1-3H3,(H2,32,39)/t15?,17-,30-/m0/s1 |
| InChIKey | YOKQARZBIIQCOV-ZKARSKKDSA-N |
| XLogP | 3.73 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|