C31H33ClN2O7 — CID 126597928
(4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[methyl-(2-methyl-2-phenylpropyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126597928) has the molecular formula C31H33ClN2O7 and a molecular weight of 581.07 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[methyl-(2-methyl-2-phenylpropyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[methyl-(2-methyl-2-phenylpropyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126597928 |
| Molecular Formula | C31H33ClN2O7 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[[methyl-(2-methyl-2-phenylpropyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(Cc1cc(O)c2c(c1Cl)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H33ClN2O7/c1-30(2,17-7-5-4-6-8-17)14-34(3)13-16-11-20(35)23-19(25(16)32)10-15-9-18-12-21(36)24(29(33)40)28(39)31(18,41)27(38)22(15)26(23)37/h4-8,11,15,18,35,37,39,41H,9-10,12-14H2,1-3H3,(H2,33,40)/t15?,18-,31-/m0/s1 |
| InChIKey | JFNVTZDMFKUVTD-VJWVPQJSSA-N |
| XLogP | 3.49 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|